About 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene]
7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene] (PubChem CID 18996063) has the molecular formula C11H11BrO3
and a molecular weight of 271.11 g/mol. Its IUPAC name is 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene].
Molecular Properties
| Compound Name | 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene] |
| PubChem CID | 18996063 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene] |
| SMILES | Brc1ccc2c(c1)OCCC21OCCO1 |
| InChI | InChI=1S/C11H11BrO3/c12-8-1-2-9-10(7-8)13-4-3-11(9)14-5-6-15-11/h1-2,7H,3-6H2 |
| InChIKey | YZKUZIHEVQTJIL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene]?
The IUPAC name of 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene] (CID 18996063) is 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene].
What is the SMILES notation for 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene]?
The canonical SMILES for 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene] is Brc1ccc2c(c1)OCCC21OCCO1.
What is the InChIKey of 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene]?
The InChIKey is YZKUZIHEVQTJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO3/c12-8-1-2-9-10(7-8)13-4-3-11(9)14-5-6-15-11/h1-2,7H,3-6H2.
What are the key properties of 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene]?
7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene] has a molecular weight of 271.11 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-bromospiro[1,3-dioxolane-2,4'-2,3-dihydrochromene] is sourced from PubChem (CID 18996063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).