About 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol
4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol (PubChem CID 18996070) has the molecular formula C10H12O2S
and a molecular weight of 196.27 g/mol. Its IUPAC name is 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol.
Molecular Properties
| Compound Name | 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol |
| PubChem CID | 18996070 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol |
| SMILES | CC1(c2ccc(S)cc2)OCCO1 |
| InChI | InChI=1S/C10H12O2S/c1-10(11-6-7-12-10)8-2-4-9(13)5-3-8/h2-5,13H,6-7H2,1H3 |
| InChIKey | HRQXDWVFPQBPJQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol?
The IUPAC name of 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol (CID 18996070) is 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol.
What is the SMILES notation for 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol?
The canonical SMILES for 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol is CC1(c2ccc(S)cc2)OCCO1.
What is the InChIKey of 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol?
The InChIKey is HRQXDWVFPQBPJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2S/c1-10(11-6-7-12-10)8-2-4-9(13)5-3-8/h2-5,13H,6-7H2,1H3.
What are the key properties of 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol?
4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol has a molecular weight of 196.27 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,3-dioxolan-2-yl)benzenethiol is sourced from PubChem (CID 18996070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).