About 2-(4-methoxyoxan-4-yl)-1,3-thiazole
2-(4-methoxyoxan-4-yl)-1,3-thiazole (PubChem CID 18996201) has the molecular formula C9H13NO2S
and a molecular weight of 199.27 g/mol. Its IUPAC name is 2-(4-methoxyoxan-4-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(4-methoxyoxan-4-yl)-1,3-thiazole |
| PubChem CID | 18996201 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-(4-methoxyoxan-4-yl)-1,3-thiazole |
| SMILES | COC1(c2nccs2)CCOCC1 |
| InChI | InChI=1S/C9H13NO2S/c1-11-9(2-5-12-6-3-9)8-10-4-7-13-8/h4,7H,2-3,5-6H2,1H3 |
| InChIKey | LKTZQMNCZQVWST-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methoxyoxan-4-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyoxan-4-yl)-1,3-thiazole?
The IUPAC name of 2-(4-methoxyoxan-4-yl)-1,3-thiazole (CID 18996201) is 2-(4-methoxyoxan-4-yl)-1,3-thiazole.
What is the SMILES notation for 2-(4-methoxyoxan-4-yl)-1,3-thiazole?
The canonical SMILES for 2-(4-methoxyoxan-4-yl)-1,3-thiazole is COC1(c2nccs2)CCOCC1.
What is the InChIKey of 2-(4-methoxyoxan-4-yl)-1,3-thiazole?
The InChIKey is LKTZQMNCZQVWST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-11-9(2-5-12-6-3-9)8-10-4-7-13-8/h4,7H,2-3,5-6H2,1H3.
What are the key properties of 2-(4-methoxyoxan-4-yl)-1,3-thiazole?
2-(4-methoxyoxan-4-yl)-1,3-thiazole has a molecular weight of 199.27 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyoxan-4-yl)-1,3-thiazole is sourced from PubChem (CID 18996201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).