C20H24Si — CID 18996423
[cyclopenta-1,3-dien-1-yl-(2-cyclopenta-1,3-dien-1-ylphenyl)methyl]-trimethylsilane (PubChem CID 18996423) has the molecular formula C20H24Si and a molecular weight of 292.50 g/mol. Its IUPAC name is [cyclopenta-1,3-dien-1-yl-(2-cyclopenta-1,3-dien-1-ylphenyl)methyl]-trimethylsilane.
| Compound Name | [cyclopenta-1,3-dien-1-yl-(2-cyclopenta-1,3-dien-1-ylphenyl)methyl]-trimethylsilane |
|---|---|
| PubChem CID | 18996423 |
| Molecular Formula | C20H24Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | [cyclopenta-1,3-dien-1-yl-(2-cyclopenta-1,3-dien-1-ylphenyl)methyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(C1=CC=CC1)c1ccccc1C1=CC=CC1 |
| InChI | InChI=1S/C20H24Si/c1-21(2,3)20(17-12-6-7-13-17)19-15-9-8-14-18(19)16-10-4-5-11-16/h4-10,12,14-15,20H,11,13H2,1-3H3 |
| InChIKey | PVSNALQLAQTAGU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|