C29H16F12O6S2 — CID 18996464
1-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(trifluoromethylsulfonyl)phenoxy]phenyl]propan-2-yl]-4-[4-(trifluoromethylsulfonyl)phenoxy]benzene (PubChem CID 18996464) has the molecular formula C29H16F12O6S2 and a molecular weight of 752.55 g/mol. Its IUPAC name is 1-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(trifluoromethylsulfonyl)phenoxy]phenyl]propan-2-yl]-4-[4-(trifluoromethylsulfonyl)phenoxy]benzene.
| Compound Name | 1-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(trifluoromethylsulfonyl)phenoxy]phenyl]propan-2-yl]-4-[4-(trifluoromethylsulfonyl)phenoxy]benzene |
|---|---|
| PubChem CID | 18996464 |
| Molecular Formula | C29H16F12O6S2 |
| Molecular Weight | 752.55 g/mol |
| Exact Mass | 752.02 |
| IUPAC Name | 1-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(trifluoromethylsulfonyl)phenoxy]phenyl]propan-2-yl]-4-[4-(trifluoromethylsulfonyl)phenoxy]benzene |
| SMILES | O=S(=O)(c1ccc(Oc2ccc(C(c3ccc(Oc4ccc(S(=O)(=O)C(F)(F)F)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C29H16F12O6S2/c30-26(31,32)25(27(33,34)35,17-1-5-19(6-2-17)46-21-9-13-23(14-10-21)48(42,43)28(36,37)38)18-3-7-20(8-4-18)47-22-11-15-24(16-12-22)49(44,45)29(39,40)41/h1-16H |
| InChIKey | DUDYFYHUFNNVIJ-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.55 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |