C9H17F3OSi — CID 18997289
2,6-dimethyl-2-(1,1,2-trifluoropropyl)oxasilinane (PubChem CID 18997289) has the molecular formula C9H17F3OSi and a molecular weight of 226.31 g/mol. Its IUPAC name is 2,6-dimethyl-2-(1,1,2-trifluoropropyl)oxasilinane.
| Compound Name | 2,6-dimethyl-2-(1,1,2-trifluoropropyl)oxasilinane |
|---|---|
| PubChem CID | 18997289 |
| Molecular Formula | C9H17F3OSi |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2,6-dimethyl-2-(1,1,2-trifluoropropyl)oxasilinane |
| SMILES | CC1CCC[Si](C)(C(F)(F)C(C)F)O1 |
| InChI | InChI=1S/C9H17F3OSi/c1-7-5-4-6-14(3,13-7)9(11,12)8(2)10/h7-8H,4-6H2,1-3H3 |
| InChIKey | HCTCRQGSIAYVFL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|