About 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid
4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid (PubChem CID 18997319) has the molecular formula C16H8I2O8
and a molecular weight of 582.04 g/mol. Its IUPAC name is 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid.
Molecular Properties
| Compound Name | 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid |
| PubChem CID | 18997319 |
| Molecular Formula | C16H8I2O8 |
| Molecular Weight | 582.04 g/mol |
| Exact Mass | 581.83 |
| IUPAC Name | 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid |
| SMILES | O=C(O)c1cc(I)c(-c2cc(C(=O)O)c(C(=O)O)cc2I)cc1C(=O)O |
| InChI | InChI=1S/C16H8I2O8/c17-11-3-9(15(23)24)7(13(19)20)1-5(11)6-2-8(14(21)22)10(16(25)26)4-12(6)18/h1-4H,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | WBMPFPXZYDLBFN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 582.04 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid?
The IUPAC name of 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid (CID 18997319) is 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid.
What is the SMILES notation for 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid?
The canonical SMILES for 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid is O=C(O)c1cc(I)c(-c2cc(C(=O)O)c(C(=O)O)cc2I)cc1C(=O)O.
What is the InChIKey of 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid?
The InChIKey is WBMPFPXZYDLBFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8I2O8/c17-11-3-9(15(23)24)7(13(19)20)1-5(11)6-2-8(14(21)22)10(16(25)26)4-12(6)18/h1-4H,(H,19,20)(H,21,22)(H,23,24)(H,25,26).
What are the key properties of 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid?
4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid has a molecular weight of 582.04 g/mol, XLogP of 3.36, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dicarboxy-2-iodophenyl)-5-iodophthalic acid is sourced from PubChem (CID 18997319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).