About butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane
butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane (PubChem CID 18997487) has the molecular formula C14H24O5
and a molecular weight of 272.34 g/mol. Its IUPAC name is butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane.
Molecular Properties
| Compound Name | butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane |
| PubChem CID | 18997487 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane |
| SMILES | CCCCOC(=O)C1=CC(=O)CC(C)(C)O1.COC |
| InChI | InChI=1S/C12H18O4.C2H6O/c1-4-5-6-15-11(14)10-7-9(13)8-12(2,3)16-10;1-3-2/h7H,4-6,8H2,1-3H3;1-2H3 |
| InChIKey | HRAJCMANSDWAOX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane?
The IUPAC name of butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane (CID 18997487) is butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane.
What is the SMILES notation for butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane?
The canonical SMILES for butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane is CCCCOC(=O)C1=CC(=O)CC(C)(C)O1.COC.
What is the InChIKey of butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane?
The InChIKey is HRAJCMANSDWAOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4.C2H6O/c1-4-5-6-15-11(14)10-7-9(13)8-12(2,3)16-10;1-3-2/h7H,4-6,8H2,1-3H3;1-2H3.
What are the key properties of butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane?
butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane has a molecular weight of 272.34 g/mol, XLogP of 2.24, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;methoxymethane is sourced from PubChem (CID 18997487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).