About methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate
methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate (PubChem CID 18997974) has the molecular formula C10H19NO5
and a molecular weight of 233.26 g/mol. Its IUPAC name is methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate.
Molecular Properties
| Compound Name | methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate |
| PubChem CID | 18997974 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate |
| SMILES | C=CC(=O)NC(O)C(=O)OC(C)C.COC |
| InChI | InChI=1S/C8H13NO4.C2H6O/c1-4-6(10)9-7(11)8(12)13-5(2)3;1-3-2/h4-5,7,11H,1H2,2-3H3,(H,9,10);1-2H3 |
| InChIKey | FJPJANIEIHBXCD-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate?
The IUPAC name of methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate (CID 18997974) is methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate.
What is the SMILES notation for methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate?
The canonical SMILES for methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate is C=CC(=O)NC(O)C(=O)OC(C)C.COC.
What is the InChIKey of methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate?
The InChIKey is FJPJANIEIHBXCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO4.C2H6O/c1-4-6(10)9-7(11)8(12)13-5(2)3;1-3-2/h4-5,7,11H,1H2,2-3H3,(H,9,10);1-2H3.
What are the key properties of methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate?
methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate has a molecular weight of 233.26 g/mol, XLogP of -0.18, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;propan-2-yl 2-hydroxy-2-(prop-2-enoylamino)acetate is sourced from PubChem (CID 18997974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).