C25H30ClN3 — CID 18998034
4-[(2-chloroanilino)-[4-(dimethylamino)-2-methylphenyl]methyl]-N,N,3-trimethylaniline (PubChem CID 18998034) has the molecular formula C25H30ClN3 and a molecular weight of 407.99 g/mol. Its IUPAC name is 4-[(2-chloroanilino)-[4-(dimethylamino)-2-methylphenyl]methyl]-N,N,3-trimethylaniline.
| Compound Name | 4-[(2-chloroanilino)-[4-(dimethylamino)-2-methylphenyl]methyl]-N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 18998034 |
| Molecular Formula | C25H30ClN3 |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 4-[(2-chloroanilino)-[4-(dimethylamino)-2-methylphenyl]methyl]-N,N,3-trimethylaniline |
| SMILES | Cc1cc(N(C)C)ccc1C(Nc1ccccc1Cl)c1ccc(N(C)C)cc1C |
| InChI | InChI=1S/C25H30ClN3/c1-17-15-19(28(3)4)11-13-21(17)25(27-24-10-8-7-9-23(24)26)22-14-12-20(29(5)6)16-18(22)2/h7-16,25,27H,1-6H3 |
| InChIKey | HKHVWYMNGOELKD-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|