C17H25N7O — CID 18998597
4-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)cyclohexane-1-carboxamide (PubChem CID 18998597) has the molecular formula C17H25N7O and a molecular weight of 343.44 g/mol. Its IUPAC name is 4-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 18998597 |
| Molecular Formula | C17H25N7O |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 4-[[methyl-(N'-methylcarbamimidoyl)amino]methyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)cyclohexane-1-carboxamide |
| SMILES | C/N=C(\N)N(C)CC1CCC(C(=O)Nc2ccnc3[nH]ncc23)CC1 |
| InChI | InChI=1S/C17H25N7O/c1-19-17(18)24(2)10-11-3-5-12(6-4-11)16(25)22-14-7-8-20-15-13(14)9-21-23-15/h7-9,11-12H,3-6,10H2,1-2H3,(H2,18,19)(H2,20,21,22,23,25) |
| InChIKey | YVSBNRKTHHBBCD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|