About 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole
2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole (PubChem CID 18998778) has the molecular formula C11H16ClNO2S
and a molecular weight of 261.77 g/mol. Its IUPAC name is 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole |
| PubChem CID | 18998778 |
| Molecular Formula | C11H16ClNO2S |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole |
| SMILES | COC1(c2cnc(Cl)s2)CCOC(C)(C)C1 |
| InChI | InChI=1S/C11H16ClNO2S/c1-10(2)7-11(14-3,4-5-15-10)8-6-13-9(12)16-8/h6H,4-5,7H2,1-3H3 |
| InChIKey | HRBYPLDZWZEBDW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole?
The IUPAC name of 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole (CID 18998778) is 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole.
What is the SMILES notation for 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole?
The canonical SMILES for 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole is COC1(c2cnc(Cl)s2)CCOC(C)(C)C1.
What is the InChIKey of 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole?
The InChIKey is HRBYPLDZWZEBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClNO2S/c1-10(2)7-11(14-3,4-5-15-10)8-6-13-9(12)16-8/h6H,4-5,7H2,1-3H3.
What are the key properties of 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole?
2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole has a molecular weight of 261.77 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(4-methoxy-2,2-dimethyloxan-4-yl)-1,3-thiazole is sourced from PubChem (CID 18998778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).