C25H26FN3O5 — CID 18998809
3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 6,7-dihydro-[1,3]dioxolo[4,5-f]indole-5-carboxylate (PubChem CID 18998809) has the molecular formula C25H26FN3O5 and a molecular weight of 467.50 g/mol. Its IUPAC name is 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 6,7-dihydro-[1,3]dioxolo[4,5-f]indole-5-carboxylate.
| Compound Name | 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 6,7-dihydro-[1,3]dioxolo[4,5-f]indole-5-carboxylate |
|---|---|
| PubChem CID | 18998809 |
| Molecular Formula | C25H26FN3O5 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl 6,7-dihydro-[1,3]dioxolo[4,5-f]indole-5-carboxylate |
| SMILES | O=C(OCCCN1CCC(c2noc3cc(F)ccc23)CC1)N1CCc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C25H26FN3O5/c26-18-2-3-19-21(13-18)34-27-24(19)16-4-8-28(9-5-16)7-1-11-31-25(30)29-10-6-17-12-22-23(14-20(17)29)33-15-32-22/h2-3,12-14,16H,1,4-11,15H2 |
| InChIKey | YVGIYBUNWDUHAM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 77.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|