C10H11NO2 — CID 18998824
5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinoline (PubChem CID 18998824) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinoline.
| Compound Name | 5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinoline |
|---|---|
| PubChem CID | 18998824 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinoline |
| SMILES | c1c2c(cc3c1OCO3)NCCC2 |
| InChI | InChI=1S/C10H11NO2/c1-2-7-4-9-10(13-6-12-9)5-8(7)11-3-1/h4-5,11H,1-3,6H2 |
| InChIKey | UMUXOAUTRXNEMQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|