C21H23FN2O4S — CID 18998847
N-[4-[2-[3-(4-fluorobenzoyl)piperidin-1-yl]acetyl]phenyl]methanesulfonamide (PubChem CID 18998847) has the molecular formula C21H23FN2O4S and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[4-[2-[3-(4-fluorobenzoyl)piperidin-1-yl]acetyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-[3-(4-fluorobenzoyl)piperidin-1-yl]acetyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18998847 |
| Molecular Formula | C21H23FN2O4S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[4-[2-[3-(4-fluorobenzoyl)piperidin-1-yl]acetyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)CN2CCCC(C(=O)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C21H23FN2O4S/c1-29(27,28)23-19-10-6-15(7-11-19)20(25)14-24-12-2-3-17(13-24)21(26)16-4-8-18(22)9-5-16/h4-11,17,23H,2-3,12-14H2,1H3 |
| InChIKey | JTABYJTVMBUCBC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |