About zinc 3-(bromomethyl)benzonitrile
zinc 3-(bromomethyl)benzonitrile (PubChem CID 18999076) has the molecular formula C8H6BrNZn+2
and a molecular weight of 261.44 g/mol. Its IUPAC name is zinc 3-(bromomethyl)benzonitrile.
Molecular Properties
| Compound Name | zinc 3-(bromomethyl)benzonitrile |
| PubChem CID | 18999076 |
| Molecular Formula | C8H6BrNZn+2 |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 258.90 |
| IUPAC Name | zinc 3-(bromomethyl)benzonitrile |
| SMILES | N#Cc1cccc(CBr)c1.[Zn+2] |
| InChI | InChI=1S/C8H6BrN.Zn/c9-5-7-2-1-3-8(4-7)6-10;/h1-4H,5H2;/q;+2 |
| InChIKey | XZLOXLFNUXBHGJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc 3-(bromomethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc 3-(bromomethyl)benzonitrile?
The IUPAC name of zinc 3-(bromomethyl)benzonitrile (CID 18999076) is zinc 3-(bromomethyl)benzonitrile.
What is the SMILES notation for zinc 3-(bromomethyl)benzonitrile?
The canonical SMILES for zinc 3-(bromomethyl)benzonitrile is N#Cc1cccc(CBr)c1.[Zn+2].
What is the InChIKey of zinc 3-(bromomethyl)benzonitrile?
The InChIKey is XZLOXLFNUXBHGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN.Zn/c9-5-7-2-1-3-8(4-7)6-10;/h1-4H,5H2;/q;+2.
What are the key properties of zinc 3-(bromomethyl)benzonitrile?
zinc 3-(bromomethyl)benzonitrile has a molecular weight of 261.44 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc 3-(bromomethyl)benzonitrile is sourced from PubChem (CID 18999076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).