C16H22ClN3O — CID 18999470
5-(4-chlorophenyl)-2,2-dimethyl-3-(1,2,4-triazol-1-yl)hexan-3-ol (PubChem CID 18999470) has the molecular formula C16H22ClN3O and a molecular weight of 307.83 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,2-dimethyl-3-(1,2,4-triazol-1-yl)hexan-3-ol.
| Compound Name | 5-(4-chlorophenyl)-2,2-dimethyl-3-(1,2,4-triazol-1-yl)hexan-3-ol |
|---|---|
| PubChem CID | 18999470 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 5-(4-chlorophenyl)-2,2-dimethyl-3-(1,2,4-triazol-1-yl)hexan-3-ol |
| SMILES | CC(CC(O)(n1cncn1)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClN3O/c1-12(13-5-7-14(17)8-6-13)9-16(21,15(2,3)4)20-11-18-10-19-20/h5-8,10-12,21H,9H2,1-4H3 |
| InChIKey | MSWJNFXEBQUGHQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |