C19H25NO4S — CID 18999495
N-[[1-[[4-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]furan-2-sulfonamide (PubChem CID 18999495) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-[[1-[[4-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]furan-2-sulfonamide.
| Compound Name | N-[[1-[[4-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 18999495 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[[1-[[4-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]furan-2-sulfonamide |
| SMILES | O=S(=O)(NCC1(Cc2ccc(CCO)cc2)CCCC1)c1ccco1 |
| InChI | InChI=1S/C19H25NO4S/c21-12-9-16-5-7-17(8-6-16)14-19(10-1-2-11-19)15-20-25(22,23)18-4-3-13-24-18/h3-8,13,20-21H,1-2,9-12,14-15H2 |
| InChIKey | NPUYMSACWLOQMD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |