About 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline
7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline (PubChem CID 18999805) has the molecular formula C17H14N4O2
and a molecular weight of 306.33 g/mol. Its IUPAC name is 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline.
Molecular Properties
| Compound Name | 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline |
| PubChem CID | 18999805 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline |
| SMILES | COc1cc(OC)cc(-c2cnc3cc4cn[nH]c4cc3n2)c1 |
| InChI | InChI=1S/C17H14N4O2/c1-22-12-3-10(4-13(6-12)23-2)17-9-18-15-5-11-8-19-21-14(11)7-16(15)20-17/h3-9H,1-2H3,(H,19,21) |
| InChIKey | CFXLPQMPIMZXDZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline?
The IUPAC name of 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline (CID 18999805) is 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline.
What is the SMILES notation for 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline?
The canonical SMILES for 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline is COc1cc(OC)cc(-c2cnc3cc4cn[nH]c4cc3n2)c1.
What is the InChIKey of 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline?
The InChIKey is CFXLPQMPIMZXDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O2/c1-22-12-3-10(4-13(6-12)23-2)17-9-18-15-5-11-8-19-21-14(11)7-16(15)20-17/h3-9H,1-2H3,(H,19,21).
What are the key properties of 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline?
7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline has a molecular weight of 306.33 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,5-dimethoxyphenyl)-1H-pyrazolo[4,3-g]quinoxaline is sourced from PubChem (CID 18999805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).