About 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline
7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline (PubChem CID 18999821) has the molecular formula C15H9FN4
and a molecular weight of 264.26 g/mol. Its IUPAC name is 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline.
Molecular Properties
| Compound Name | 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline |
| PubChem CID | 18999821 |
| Molecular Formula | C15H9FN4 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline |
| SMILES | Fc1cccc(-c2cnc3cc4cn[nH]c4cc3n2)c1 |
| InChI | InChI=1S/C15H9FN4/c16-11-3-1-2-9(4-11)15-8-17-13-5-10-7-18-20-12(10)6-14(13)19-15/h1-8H,(H,18,20) |
| InChIKey | UBYMYOZKZZTNAH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline?
The IUPAC name of 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline (CID 18999821) is 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline.
What is the SMILES notation for 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline?
The canonical SMILES for 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline is Fc1cccc(-c2cnc3cc4cn[nH]c4cc3n2)c1.
What is the InChIKey of 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline?
The InChIKey is UBYMYOZKZZTNAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9FN4/c16-11-3-1-2-9(4-11)15-8-17-13-5-10-7-18-20-12(10)6-14(13)19-15/h1-8H,(H,18,20).
What are the key properties of 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline?
7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline has a molecular weight of 264.26 g/mol, XLogP of 3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-fluorophenyl)-1H-pyrazolo[4,3-g]quinoxaline is sourced from PubChem (CID 18999821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).