About 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline
6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline (PubChem CID 18999842) has the molecular formula C17H14N4
and a molecular weight of 274.33 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline.
Molecular Properties
| Compound Name | 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline |
| PubChem CID | 18999842 |
| Molecular Formula | C17H14N4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline |
| SMILES | Cc1ccc(-c2cnc3cc4[nH]ncc4cc3n2)cc1C |
| InChI | InChI=1S/C17H14N4/c1-10-3-4-12(5-11(10)2)17-9-18-15-7-14-13(8-19-21-14)6-16(15)20-17/h3-9H,1-2H3,(H,19,21) |
| InChIKey | AWCZTZNATBNPFO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline?
The IUPAC name of 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline (CID 18999842) is 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline.
What is the SMILES notation for 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline?
The canonical SMILES for 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline is Cc1ccc(-c2cnc3cc4[nH]ncc4cc3n2)cc1C.
What is the InChIKey of 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline?
The InChIKey is AWCZTZNATBNPFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4/c1-10-3-4-12(5-11(10)2)17-9-18-15-7-14-13(8-19-21-14)6-16(15)20-17/h3-9H,1-2H3,(H,19,21).
What are the key properties of 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline?
6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline has a molecular weight of 274.33 g/mol, XLogP of 3.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dimethylphenyl)-1H-pyrazolo[3,4-g]quinoxaline is sourced from PubChem (CID 18999842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).