C15H8Cl2N4 — CID 18999849
6-(3,5-dichlorophenyl)-1H-pyrazolo[3,4-g]quinoxaline (PubChem CID 18999849) has the molecular formula C15H8Cl2N4 and a molecular weight of 315.16 g/mol. Its IUPAC name is 6-(3,5-dichlorophenyl)-1H-pyrazolo[3,4-g]quinoxaline.
| Compound Name | 6-(3,5-dichlorophenyl)-1H-pyrazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 18999849 |
| Molecular Formula | C15H8Cl2N4 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 6-(3,5-dichlorophenyl)-1H-pyrazolo[3,4-g]quinoxaline |
| SMILES | Clc1cc(Cl)cc(-c2cnc3cc4[nH]ncc4cc3n2)c1 |
| InChI | InChI=1S/C15H8Cl2N4/c16-10-1-8(2-11(17)4-10)15-7-18-13-5-12-9(6-19-21-12)3-14(13)20-15/h1-7H,(H,19,21) |
| InChIKey | UDPYNRPHMDXUEE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |