C28H51N7O10 — CID 19000068
3-[4-[[2-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-oxoacetyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid (PubChem CID 19000068) has the molecular formula C28H51N7O10 and a molecular weight of 645.76 g/mol. Its IUPAC name is 3-[4-[[2-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-oxoacetyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid.
| Compound Name | 3-[4-[[2-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-oxoacetyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 19000068 |
| Molecular Formula | C28H51N7O10 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.37 |
| IUPAC Name | 3-[4-[[2-[6-[[(carboxyamino)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]hexylamino]-2-oxoacetyl]amino]butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylcarbamic acid |
| SMILES | CC(C)(C)OC(=O)N/C(=N/CCCCCCNC(=O)C(=O)NCCCCN(CCCNC(=O)O)C(=O)OC(C)(C)C)NC(=O)O |
| InChI | InChI=1S/C28H51N7O10/c1-27(2,3)44-25(42)34-22(33-24(40)41)31-16-10-8-7-9-14-29-20(36)21(37)30-15-11-12-18-35(19-13-17-32-23(38)39)26(43)45-28(4,5)6/h32H,7-19H2,1-6H3,(H,29,36)(H,30,37)(H,38,39)(H,40,41)(H2,31,33,34,42) |
| InChIKey | AXTDTYUILYLJIM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 237.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|