C16H22O2S2 — CID 19000492
2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid (PubChem CID 19000492) has the molecular formula C16H22O2S2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid.
| Compound Name | 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 19000492 |
| Molecular Formula | C16H22O2S2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid |
| SMILES | Cc1ccc(C)c(SC2CCCCC2SCC(=O)O)c1 |
| InChI | InChI=1S/C16H22O2S2/c1-11-7-8-12(2)15(9-11)20-14-6-4-3-5-13(14)19-10-16(17)18/h7-9,13-14H,3-6,10H2,1-2H3,(H,17,18) |
| InChIKey | ZMNMFEMHTSSSTK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |