2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid

C16H22O2S2 — CID 19000492

IUPAC2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid
SMILESCc1ccc(C)c(SC2CCCCC2SCC(=O)O)c1
InChIInChI=1S/C16H22O2S2/c1-11-7-8-12(2)15(9-11)20-14-6-4-3-5-13(14)19-10-16(17)18/h7-9,13-14H,3-6,10H2,1-2H3,(H,17,18)
InChIKeyZMNMFEMHTSSSTK-UHFFFAOYSA-N
MW310.48 g/mol
LogP4.52
Rot. Bonds5

About 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid

2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid (PubChem CID 19000492) has the molecular formula C16H22O2S2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid.

Molecular Properties

Compound Name2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid
PubChem CID19000492
Molecular FormulaC16H22O2S2
Molecular Weight310.48 g/mol
Exact Mass310.11
IUPAC Name2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid
SMILESCc1ccc(C)c(SC2CCCCC2SCC(=O)O)c1
InChIInChI=1S/C16H22O2S2/c1-11-7-8-12(2)15(9-11)20-14-6-4-3-5-13(14)19-10-16(17)18/h7-9,13-14H,3-6,10H2,1-2H3,(H,17,18)
InChIKeyZMNMFEMHTSSSTK-UHFFFAOYSA-N
XLogP4.52
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.48
LogP ≤ 54.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid?
The IUPAC name of 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid (CID 19000492) is 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid.
What is the SMILES notation for 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid?
The canonical SMILES for 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid is Cc1ccc(C)c(SC2CCCCC2SCC(=O)O)c1.
What is the InChIKey of 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid?
The InChIKey is ZMNMFEMHTSSSTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2S2/c1-11-7-8-12(2)15(9-11)20-14-6-4-3-5-13(14)19-10-16(17)18/h7-9,13-14H,3-6,10H2,1-2H3,(H,17,18).
What are the key properties of 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid?
2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid has a molecular weight of 310.48 g/mol, XLogP of 4.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,5-dimethylphenyl)sulfanylcyclohexyl]sulfanylacetic acid is sourced from PubChem (CID 19000492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).