C7H9NS — CID 19000519
2,4,5,6-tetrahydro-1,3-benzothiazole (PubChem CID 19000519) has the molecular formula C7H9NS and a molecular weight of 139.22 g/mol. Its IUPAC name is 2,4,5,6-tetrahydro-1,3-benzothiazole.
| Compound Name | 2,4,5,6-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 19000519 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 2,4,5,6-tetrahydro-1,3-benzothiazole |
| SMILES | C1=C2SCN=C2CCC1 |
| InChI | InChI=1S/C7H9NS/c1-2-4-7-6(3-1)8-5-9-7/h4H,1-3,5H2 |
| InChIKey | KWZMVDFHILSZKS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |