C18H18O7 — CID 19000588
9-hydroxy-4,5-dimethoxy-13,13-dimethyl-12,14-dioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1,4,7,9-tetraene-3,6-dione (PubChem CID 19000588) has the molecular formula C18H18O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is 9-hydroxy-4,5-dimethoxy-13,13-dimethyl-12,14-dioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1,4,7,9-tetraene-3,6-dione.
| Compound Name | 9-hydroxy-4,5-dimethoxy-13,13-dimethyl-12,14-dioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1,4,7,9-tetraene-3,6-dione |
|---|---|
| PubChem CID | 19000588 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 9-hydroxy-4,5-dimethoxy-13,13-dimethyl-12,14-dioxatetracyclo[8.6.0.02,7.011,15]hexadeca-1,4,7,9-tetraene-3,6-dione |
| SMILES | COC1=C(OC)C(=O)c2c(cc(O)c3c2CC2OC(C)(C)OC32)C1=O |
| InChI | InChI=1S/C18H18O7/c1-18(2)24-10-6-7-11-8(5-9(19)12(7)15(10)25-18)13(20)16(22-3)17(23-4)14(11)21/h5,10,15,19H,6H2,1-4H3 |
| InChIKey | ITQVTMZGHRFCRG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|