About 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol
1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol (PubChem CID 19000646) has the molecular formula C19H40O3Si2
and a molecular weight of 372.70 g/mol. Its IUPAC name is 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol.
Molecular Properties
| Compound Name | 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol |
| PubChem CID | 19000646 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol |
| SMILES | CC(O)C1=CCC(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O3Si2/c1-14(20)15-12-13-16(21-23(8,9)18(2,3)4)17(15)22-24(10,11)19(5,6)7/h12,14,16-17,20H,13H2,1-11H3 |
| InChIKey | BLBRGSGUUZVJSI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol?
The IUPAC name of 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol (CID 19000646) is 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol.
What is the SMILES notation for 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol?
The canonical SMILES for 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol is CC(O)C1=CCC(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol?
The InChIKey is BLBRGSGUUZVJSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O3Si2/c1-14(20)15-12-13-16(21-23(8,9)18(2,3)4)17(15)22-24(10,11)19(5,6)7/h12,14,16-17,20H,13H2,1-11H3.
What are the key properties of 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol?
1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol has a molecular weight of 372.70 g/mol, XLogP of 5.48, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclopenten-1-yl]ethanol is sourced from PubChem (CID 19000646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).