About (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate
(2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate (PubChem CID 19000661) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate.
Molecular Properties
| Compound Name | (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate |
| PubChem CID | 19000661 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate |
| SMILES | COC1(C)OC2CC=C(OC(C)=O)C2O1 |
| InChI | InChI=1S/C10H14O5/c1-6(11)13-7-4-5-8-9(7)15-10(2,12-3)14-8/h4,8-9H,5H2,1-3H3 |
| InChIKey | UAXPDLVTVREXPT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate?
The IUPAC name of (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate (CID 19000661) is (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate.
What is the SMILES notation for (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate?
The canonical SMILES for (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate is COC1(C)OC2CC=C(OC(C)=O)C2O1.
What is the InChIKey of (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate?
The InChIKey is UAXPDLVTVREXPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5/c1-6(11)13-7-4-5-8-9(7)15-10(2,12-3)14-8/h4,8-9H,5H2,1-3H3.
What are the key properties of (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate?
(2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate has a molecular weight of 214.22 g/mol, XLogP of 0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-methyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl) acetate is sourced from PubChem (CID 19000661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).