C34H39Cl3O12 — CID 19000751
[4,12-diacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-9-(2,2,2-trichloroethoxycarbonyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 19000751) has the molecular formula C34H39Cl3O12 and a molecular weight of 746.03 g/mol. Its IUPAC name is [4,12-diacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-9-(2,2,2-trichloroethoxycarbonyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [4,12-diacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-9-(2,2,2-trichloroethoxycarbonyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 19000751 |
| Molecular Formula | C34H39Cl3O12 |
| Molecular Weight | 746.03 g/mol |
| Exact Mass | 744.15 |
| IUPAC Name | [4,12-diacetyloxy-1-hydroxy-10,14,17,17-tetramethyl-11-oxo-9-(2,2,2-trichloroethoxycarbonyloxy)-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC(=O)OC1C(=O)C2(C)C(OC(=O)OCC(Cl)(Cl)Cl)CC3OCC3(OC(C)=O)C2C(OC(=O)c2ccccc2)C2(O)CCC(C)=C1C2(C)C |
| InChI | InChI=1S/C34H39Cl3O12/c1-17-12-13-33(43)27(48-28(41)20-10-8-7-9-11-20)25-31(6,26(40)24(46-18(2)38)23(17)30(33,4)5)21(47-29(42)45-16-34(35,36)37)14-22-32(25,15-44-22)49-19(3)39/h7-11,21-22,24-25,27,43H,12-16H2,1-6H3 |
| InChIKey | ZHWZNSMBBSZDAG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.03 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|