About (E)-4-iodopent-2-ene
(E)-4-iodopent-2-ene (PubChem CID 19000793) has the molecular formula C5H9I
and a molecular weight of 196.03 g/mol. Its IUPAC name is (E)-4-iodopent-2-ene.
Molecular Properties
| Compound Name | (E)-4-iodopent-2-ene |
| PubChem CID | 19000793 |
| Molecular Formula | C5H9I |
| Molecular Weight | 196.03 g/mol |
| Exact Mass | 195.97 |
| IUPAC Name | (E)-4-iodopent-2-ene |
| SMILES | C/C=C/C(C)I |
| InChI | InChI=1S/C5H9I/c1-3-4-5(2)6/h3-5H,1-2H3/b4-3+ |
| InChIKey | CBKHINNDWVYCIK-ONEGZZNKSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.03 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-iodopent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-iodopent-2-ene?
The IUPAC name of (E)-4-iodopent-2-ene (CID 19000793) is (E)-4-iodopent-2-ene.
What is the SMILES notation for (E)-4-iodopent-2-ene?
The canonical SMILES for (E)-4-iodopent-2-ene is C/C=C/C(C)I.
What is the InChIKey of (E)-4-iodopent-2-ene?
The InChIKey is CBKHINNDWVYCIK-ONEGZZNKSA-N. The full InChI is InChI=1S/C5H9I/c1-3-4-5(2)6/h3-5H,1-2H3/b4-3+.
What are the key properties of (E)-4-iodopent-2-ene?
(E)-4-iodopent-2-ene has a molecular weight of 196.03 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-iodopent-2-ene is sourced from PubChem (CID 19000793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).