C20H15ClF3N3O2 — CID 19001397
7-chloro-3a-ethenyl-N-[4-(trifluoromethyl)phenyl]-3,4-dihydrochromeno[4,3-c]pyrazole-2-carboxamide (PubChem CID 19001397) has the molecular formula C20H15ClF3N3O2 and a molecular weight of 421.81 g/mol. Its IUPAC name is 7-chloro-3a-ethenyl-N-[4-(trifluoromethyl)phenyl]-3,4-dihydrochromeno[4,3-c]pyrazole-2-carboxamide.
| Compound Name | 7-chloro-3a-ethenyl-N-[4-(trifluoromethyl)phenyl]-3,4-dihydrochromeno[4,3-c]pyrazole-2-carboxamide |
|---|---|
| PubChem CID | 19001397 |
| Molecular Formula | C20H15ClF3N3O2 |
| Molecular Weight | 421.81 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 7-chloro-3a-ethenyl-N-[4-(trifluoromethyl)phenyl]-3,4-dihydrochromeno[4,3-c]pyrazole-2-carboxamide |
| SMILES | C=CC12COc3cc(Cl)ccc3C1=NN(C(=O)Nc1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C20H15ClF3N3O2/c1-2-19-10-27(18(28)25-14-6-3-12(4-7-14)20(22,23)24)26-17(19)15-8-5-13(21)9-16(15)29-11-19/h2-9H,1,10-11H2,(H,25,28) |
| InChIKey | KIPKHUSHADOVHD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.81 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|