About 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate
2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate (PubChem CID 19001642) has the molecular formula C18H19NO4S2
and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate |
| PubChem CID | 19001642 |
| Molecular Formula | C18H19NO4S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate |
| SMILES | O=C(OCCSSCCCc1ccc2c(c1)OCO2)c1cccnc1 |
| InChI | InChI=1S/C18H19NO4S2/c20-18(15-4-1-7-19-12-15)21-8-10-25-24-9-2-3-14-5-6-16-17(11-14)23-13-22-16/h1,4-7,11-12H,2-3,8-10,13H2 |
| InChIKey | GRUOPBWKNRBEKZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate?
The IUPAC name of 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate (CID 19001642) is 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate.
What is the SMILES notation for 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate?
The canonical SMILES for 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate is O=C(OCCSSCCCc1ccc2c(c1)OCO2)c1cccnc1.
What is the InChIKey of 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate?
The InChIKey is GRUOPBWKNRBEKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO4S2/c20-18(15-4-1-7-19-12-15)21-8-10-25-24-9-2-3-14-5-6-16-17(11-14)23-13-22-16/h1,4-7,11-12H,2-3,8-10,13H2.
What are the key properties of 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate?
2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate has a molecular weight of 377.49 g/mol, XLogP of 3.98, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,3-benzodioxol-5-yl)propyldisulfanyl]ethyl pyridine-3-carboxylate is sourced from PubChem (CID 19001642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).