About N-fluorobutanamide
N-fluorobutanamide (PubChem CID 19001751) has the molecular formula C4H8FNO
and a molecular weight of 105.11 g/mol. Its IUPAC name is N-fluorobutanamide.
Molecular Properties
| Compound Name | N-fluorobutanamide |
| PubChem CID | 19001751 |
| Molecular Formula | C4H8FNO |
| Molecular Weight | 105.11 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | N-fluorobutanamide |
| SMILES | CCCC(=O)NF |
| InChI | InChI=1S/C4H8FNO/c1-2-3-4(7)6-5/h2-3H2,1H3,(H,6,7) |
| InChIKey | JPYULMOYFWFSBT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.11 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-fluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluorobutanamide?
The IUPAC name of N-fluorobutanamide (CID 19001751) is N-fluorobutanamide.
What is the SMILES notation for N-fluorobutanamide?
The canonical SMILES for N-fluorobutanamide is CCCC(=O)NF.
What is the InChIKey of N-fluorobutanamide?
The InChIKey is JPYULMOYFWFSBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8FNO/c1-2-3-4(7)6-5/h2-3H2,1H3,(H,6,7).
What are the key properties of N-fluorobutanamide?
N-fluorobutanamide has a molecular weight of 105.11 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluorobutanamide is sourced from PubChem (CID 19001751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).