About (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine
(E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine (PubChem CID 19001912) has the molecular formula C12H13Cl2N
and a molecular weight of 242.15 g/mol. Its IUPAC name is (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine |
| PubChem CID | 19001912 |
| Molecular Formula | C12H13Cl2N |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine |
| SMILES | C=CCNC/C=C/c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2N/c1-2-5-15-6-3-4-10-7-11(13)9-12(14)8-10/h2-4,7-9,15H,1,5-6H2/b4-3+ |
| InChIKey | NKQJTVXMIMVLGX-ONEGZZNKSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine?
The IUPAC name of (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine (CID 19001912) is (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine.
What is the SMILES notation for (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine?
The canonical SMILES for (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine is C=CCNC/C=C/c1cc(Cl)cc(Cl)c1.
What is the InChIKey of (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine?
The InChIKey is NKQJTVXMIMVLGX-ONEGZZNKSA-N. The full InChI is InChI=1S/C12H13Cl2N/c1-2-5-15-6-3-4-10-7-11(13)9-12(14)8-10/h2-4,7-9,15H,1,5-6H2/b4-3+.
What are the key properties of (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine?
(E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine has a molecular weight of 242.15 g/mol, XLogP of 3.78, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,5-dichlorophenyl)-N-prop-2-enylprop-2-en-1-amine is sourced from PubChem (CID 19001912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).