About tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate
tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate (PubChem CID 19001926) has the molecular formula C28H26N2O5
and a molecular weight of 470.53 g/mol. Its IUPAC name is tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate |
| PubChem CID | 19001926 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate |
| SMILES | CC(C)(C)OC(=O)CN(C(=O)CN1C(=O)c2ccccc2C1=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C28H26N2O5/c1-28(2,3)35-25(32)18-29(23-16-10-9-13-20(23)19-11-5-4-6-12-19)24(31)17-30-26(33)21-14-7-8-15-22(21)27(30)34/h4-16H,17-18H2,1-3H3 |
| InChIKey | LRAQSXRDRUFNDA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate?
The IUPAC name of tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate (CID 19001926) is tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate.
What is the SMILES notation for tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate?
The canonical SMILES for tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate is CC(C)(C)OC(=O)CN(C(=O)CN1C(=O)c2ccccc2C1=O)c1ccccc1-c1ccccc1.
What is the InChIKey of tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate?
The InChIKey is LRAQSXRDRUFNDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N2O5/c1-28(2,3)35-25(32)18-29(23-16-10-9-13-20(23)19-11-5-4-6-12-19)24(31)17-30-26(33)21-14-7-8-15-22(21)27(30)34/h4-16H,17-18H2,1-3H3.
What are the key properties of tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate?
tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate has a molecular weight of 470.53 g/mol, XLogP of 4.32, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]-2-phenylanilino)acetate is sourced from PubChem (CID 19001926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).