About N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride
N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride (PubChem CID 19002148) has the molecular formula C10H19ClN4
and a molecular weight of 230.74 g/mol. Its IUPAC name is N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride |
| PubChem CID | 19002148 |
| Molecular Formula | C10H19ClN4 |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride |
| SMILES | CCC/C(N)=N\c1cc(CCC)[nH]n1.Cl |
| InChI | InChI=1S/C10H18N4.ClH/c1-3-5-8-7-10(14-13-8)12-9(11)6-4-2;/h7H,3-6H2,1-2H3,(H3,11,12,13,14);1H |
| InChIKey | NZXDNAICBDURIH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride?
The IUPAC name of N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride (CID 19002148) is N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride.
What is the SMILES notation for N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride?
The canonical SMILES for N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride is CCC/C(N)=N\c1cc(CCC)[nH]n1.Cl.
What is the InChIKey of N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride?
The InChIKey is NZXDNAICBDURIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4.ClH/c1-3-5-8-7-10(14-13-8)12-9(11)6-4-2;/h7H,3-6H2,1-2H3,(H3,11,12,13,14);1H.
What are the key properties of N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride?
N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride has a molecular weight of 230.74 g/mol, XLogP of 2.57, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-propyl-1H-pyrazol-3-yl)butanimidamide;hydrochloride is sourced from PubChem (CID 19002148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).