C16H25O4P — CID 19002288
[3-(4-formylphenyl)-2,2,4,4-tetramethylpentan-3-yl]phosphonic acid (PubChem CID 19002288) has the molecular formula C16H25O4P and a molecular weight of 312.35 g/mol. Its IUPAC name is [3-(4-formylphenyl)-2,2,4,4-tetramethylpentan-3-yl]phosphonic acid.
| Compound Name | [3-(4-formylphenyl)-2,2,4,4-tetramethylpentan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 19002288 |
| Molecular Formula | C16H25O4P |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [3-(4-formylphenyl)-2,2,4,4-tetramethylpentan-3-yl]phosphonic acid |
| SMILES | CC(C)(C)C(c1ccc(C=O)cc1)(C(C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C16H25O4P/c1-14(2,3)16(15(4,5)6,21(18,19)20)13-9-7-12(11-17)8-10-13/h7-11H,1-6H3,(H2,18,19,20) |
| InChIKey | SVYSZCUTNKIQNT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|