C11H17NO5S-2 — CID 19002397
2-(N-ethyl-2-methylanilino)ethanol sulfate (PubChem CID 19002397) has the molecular formula C11H17NO5S-2 and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-(N-ethyl-2-methylanilino)ethanol sulfate.
| Compound Name | 2-(N-ethyl-2-methylanilino)ethanol sulfate |
|---|---|
| PubChem CID | 19002397 |
| Molecular Formula | C11H17NO5S-2 |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(N-ethyl-2-methylanilino)ethanol sulfate |
| SMILES | CCN(CCO)c1ccccc1C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C11H17NO.H2O4S/c1-3-12(8-9-13)11-7-5-4-6-10(11)2;1-5(2,3)4/h4-7,13H,3,8-9H2,1-2H3;(H2,1,2,3,4)/p-2 |
| InChIKey | VQALKNOYSIDTNO-UHFFFAOYSA-L |
| XLogP | 0.48 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|