C15H19NOS — CID 19002419
2,4-dimethyl-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzothiazepin-6-one (PubChem CID 19002419) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is 2,4-dimethyl-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 2,4-dimethyl-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 19002419 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2,4-dimethyl-6a,7,8,9,10,10a-hexahydro-5H-benzo[b][1,4]benzothiazepin-6-one |
| SMILES | Cc1cc(C)c2c(c1)SC1CCCCC1C(=O)N2 |
| InChI | InChI=1S/C15H19NOS/c1-9-7-10(2)14-13(8-9)18-12-6-4-3-5-11(12)15(17)16-14/h7-8,11-12H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | CJFBUWJHSLFGHC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |