About ethanol;2-methylpropan-1-ol
ethanol;2-methylpropan-1-ol (PubChem CID 19002444) has the molecular formula C8H22O3
and a molecular weight of 166.26 g/mol. Its IUPAC name is ethanol;2-methylpropan-1-ol.
Molecular Properties
| Compound Name | ethanol;2-methylpropan-1-ol |
| PubChem CID | 19002444 |
| Molecular Formula | C8H22O3 |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.16 |
| IUPAC Name | ethanol;2-methylpropan-1-ol |
| SMILES | CC(C)CO.CCO.CCO |
| InChI | InChI=1S/C4H10O.2C2H6O/c1-4(2)3-5;2*1-2-3/h4-5H,3H2,1-2H3;2*3H,2H2,1H3 |
| InChIKey | NLRGHWWVKBJAFP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethanol;2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-methylpropan-1-ol?
The IUPAC name of ethanol;2-methylpropan-1-ol (CID 19002444) is ethanol;2-methylpropan-1-ol.
What is the SMILES notation for ethanol;2-methylpropan-1-ol?
The canonical SMILES for ethanol;2-methylpropan-1-ol is CC(C)CO.CCO.CCO.
What is the InChIKey of ethanol;2-methylpropan-1-ol?
The InChIKey is NLRGHWWVKBJAFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.2C2H6O/c1-4(2)3-5;2*1-2-3/h4-5H,3H2,1-2H3;2*3H,2H2,1H3.
What are the key properties of ethanol;2-methylpropan-1-ol?
ethanol;2-methylpropan-1-ol has a molecular weight of 166.26 g/mol, XLogP of 0.63, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-methylpropan-1-ol is sourced from PubChem (CID 19002444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).