About 4,6-diaminohexanal
4,6-diaminohexanal (PubChem CID 19002458) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is 4,6-diaminohexanal.
Molecular Properties
| Compound Name | 4,6-diaminohexanal |
| PubChem CID | 19002458 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 4,6-diaminohexanal |
| SMILES | NCCC(N)CCC=O |
| InChI | InChI=1S/C6H14N2O/c7-4-3-6(8)2-1-5-9/h5-6H,1-4,7-8H2 |
| InChIKey | QERJMAWGFJYOOM-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,6-diaminohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diaminohexanal?
The IUPAC name of 4,6-diaminohexanal (CID 19002458) is 4,6-diaminohexanal.
What is the SMILES notation for 4,6-diaminohexanal?
The canonical SMILES for 4,6-diaminohexanal is NCCC(N)CCC=O.
What is the InChIKey of 4,6-diaminohexanal?
The InChIKey is QERJMAWGFJYOOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O/c7-4-3-6(8)2-1-5-9/h5-6H,1-4,7-8H2.
What are the key properties of 4,6-diaminohexanal?
4,6-diaminohexanal has a molecular weight of 130.19 g/mol, XLogP of -0.36, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diaminohexanal is sourced from PubChem (CID 19002458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).