About (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate
(3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate (PubChem CID 19003156) has the molecular formula C22H24N2O3
and a molecular weight of 364.45 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate.
Molecular Properties
| Compound Name | (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate |
| PubChem CID | 19003156 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate |
| SMILES | CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)OCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-14-8-15(2)10-17(9-14)13-27-22(26)21(24-16(3)25)11-18-12-23-20-7-5-4-6-19(18)20/h4-10,12,21,23H,11,13H2,1-3H3,(H,24,25) |
| InChIKey | YIHWPQQGVKFHTC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate?
The IUPAC name of (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate (CID 19003156) is (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate.
What is the SMILES notation for (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate?
The canonical SMILES for (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate is CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)OCc1cc(C)cc(C)c1.
What is the InChIKey of (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate?
The InChIKey is YIHWPQQGVKFHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O3/c1-14-8-15(2)10-17(9-14)13-27-22(26)21(24-16(3)25)11-18-12-23-20-7-5-4-6-19(18)20/h4-10,12,21,23H,11,13H2,1-3H3,(H,24,25).
What are the key properties of (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate?
(3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate has a molecular weight of 364.45 g/mol, XLogP of 3.58, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethylphenyl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate is sourced from PubChem (CID 19003156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).