C18H21BrN2O3 — CID 19003320
1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl bromide (PubChem CID 19003320) has the molecular formula C18H21BrN2O3 and a molecular weight of 393.28 g/mol. Its IUPAC name is 1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl bromide.
| Compound Name | 1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl bromide |
|---|---|
| PubChem CID | 19003320 |
| Molecular Formula | C18H21BrN2O3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl bromide |
| SMILES | CC1(C)CC(N2C(=O)c3ccc(C(=O)Br)cc3C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C18H21BrN2O3/c1-17(2)8-11(9-18(3,4)20-17)21-15(23)12-6-5-10(14(19)22)7-13(12)16(21)24/h5-7,11,20H,8-9H2,1-4H3 |
| InChIKey | CPAMOTFAOFLDBS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|