About 3-(chloromethyl)-5,5-dimethyl-2H-thiophene
3-(chloromethyl)-5,5-dimethyl-2H-thiophene (PubChem CID 19003453) has the molecular formula C7H11ClS
and a molecular weight of 162.68 g/mol. Its IUPAC name is 3-(chloromethyl)-5,5-dimethyl-2H-thiophene.
Molecular Properties
| Compound Name | 3-(chloromethyl)-5,5-dimethyl-2H-thiophene |
| PubChem CID | 19003453 |
| Molecular Formula | C7H11ClS |
| Molecular Weight | 162.68 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 3-(chloromethyl)-5,5-dimethyl-2H-thiophene |
| SMILES | CC1(C)C=C(CCl)CS1 |
| InChI | InChI=1S/C7H11ClS/c1-7(2)3-6(4-8)5-9-7/h3H,4-5H2,1-2H3 |
| InChIKey | FVZYWQIRTWHAHV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.68 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-5,5-dimethyl-2H-thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-5,5-dimethyl-2H-thiophene?
The IUPAC name of 3-(chloromethyl)-5,5-dimethyl-2H-thiophene (CID 19003453) is 3-(chloromethyl)-5,5-dimethyl-2H-thiophene.
What is the SMILES notation for 3-(chloromethyl)-5,5-dimethyl-2H-thiophene?
The canonical SMILES for 3-(chloromethyl)-5,5-dimethyl-2H-thiophene is CC1(C)C=C(CCl)CS1.
What is the InChIKey of 3-(chloromethyl)-5,5-dimethyl-2H-thiophene?
The InChIKey is FVZYWQIRTWHAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClS/c1-7(2)3-6(4-8)5-9-7/h3H,4-5H2,1-2H3.
What are the key properties of 3-(chloromethyl)-5,5-dimethyl-2H-thiophene?
3-(chloromethyl)-5,5-dimethyl-2H-thiophene has a molecular weight of 162.68 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-5,5-dimethyl-2H-thiophene is sourced from PubChem (CID 19003453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).