C14H14N4 — CID 19003592
4-[1-(1H-1,2,4-triazol-5-yl)cyclopentyl]benzonitrile (PubChem CID 19003592) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-[1-(1H-1,2,4-triazol-5-yl)cyclopentyl]benzonitrile.
| Compound Name | 4-[1-(1H-1,2,4-triazol-5-yl)cyclopentyl]benzonitrile |
|---|---|
| PubChem CID | 19003592 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-[1-(1H-1,2,4-triazol-5-yl)cyclopentyl]benzonitrile |
| SMILES | N#Cc1ccc(C2(c3ncn[nH]3)CCCC2)cc1 |
| InChI | InChI=1S/C14H14N4/c15-9-11-3-5-12(6-4-11)14(7-1-2-8-14)13-16-10-17-18-13/h3-6,10H,1-2,7-8H2,(H,16,17,18) |
| InChIKey | AWIMHMSWUQVZFP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |