About 1,7-Aminopropylsilane
1,7-Aminopropylsilane (PubChem CID 19003718) has the molecular formula C3H8NSi
and a molecular weight of 86.19 g/mol.
Molecular Properties
| Compound Name | 1,7-Aminopropylsilane |
| PubChem CID | 19003718 |
| Molecular Formula | C3H8NSi |
| Molecular Weight | 86.19 g/mol |
| Exact Mass | 86.04 |
| IUPAC Name | — |
| SMILES | CCC(N)[Si] |
| InChI | InChI=1S/C3H8NSi/c1-2-3(4)5/h3H,2,4H2,1H3 |
| InChIKey | DZUVUYRRBDPJDC-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.19 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,7-Aminopropylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-Aminopropylsilane?
The IUPAC name of 1,7-Aminopropylsilane (CID 19003718) is not available.
What is the SMILES notation for 1,7-Aminopropylsilane?
The canonical SMILES for 1,7-Aminopropylsilane is CCC(N)[Si].
What is the InChIKey of 1,7-Aminopropylsilane?
The InChIKey is DZUVUYRRBDPJDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8NSi/c1-2-3(4)5/h3H,2,4H2,1H3.
What are the key properties of 1,7-Aminopropylsilane?
1,7-Aminopropylsilane has a molecular weight of 86.19 g/mol, XLogP of -0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-Aminopropylsilane is sourced from PubChem (CID 19003718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).