About methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate
methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate (PubChem CID 19003811) has the molecular formula C26H28FNO5
and a molecular weight of 453.51 g/mol. Its IUPAC name is methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate.
Molecular Properties
| Compound Name | methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate |
| PubChem CID | 19003811 |
| Molecular Formula | C26H28FNO5 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate |
| SMILES | COC(=O)CC(O)CC(O)/C=C/c1c(-c2ccc(F)cc2)c2ccccc2c(=O)n1C(C)C |
| InChI | InChI=1S/C26H28FNO5/c1-16(2)28-23(13-12-19(29)14-20(30)15-24(31)33-3)25(17-8-10-18(27)11-9-17)21-6-4-5-7-22(21)26(28)32/h4-13,16,19-20,29-30H,14-15H2,1-3H3/b13-12+ |
| InChIKey | HNPJSSPOJBIEKP-OUKQBFOZSA-N |
| XLogP | 4.08 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate?
The IUPAC name of methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate (CID 19003811) is methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate.
What is the SMILES notation for methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate?
The canonical SMILES for methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate is COC(=O)CC(O)CC(O)/C=C/c1c(-c2ccc(F)cc2)c2ccccc2c(=O)n1C(C)C.
What is the InChIKey of methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate?
The InChIKey is HNPJSSPOJBIEKP-OUKQBFOZSA-N. The full InChI is InChI=1S/C26H28FNO5/c1-16(2)28-23(13-12-19(29)14-20(30)15-24(31)33-3)25(17-8-10-18(27)11-9-17)21-6-4-5-7-22(21)26(28)32/h4-13,16,19-20,29-30H,14-15H2,1-3H3/b13-12+.
What are the key properties of methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate?
methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate has a molecular weight of 453.51 g/mol, XLogP of 4.08, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-7-[4-(4-fluorophenyl)-1-oxo-2-propan-2-ylisoquinolin-3-yl]-3,5-dihydroxyhept-6-enoate is sourced from PubChem (CID 19003811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).