About 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol
4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol (PubChem CID 19003876) has the molecular formula C34H32S4
and a molecular weight of 568.90 g/mol. Its IUPAC name is 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol.
Molecular Properties
| Compound Name | 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol |
| PubChem CID | 19003876 |
| Molecular Formula | C34H32S4 |
| Molecular Weight | 568.90 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol |
| SMILES | Sc1ccc(C23CC4CC(C2)CC(c2ccc(S)cc2)(C4)C3(c2ccc(S)cc2)c2ccc(S)cc2)cc1 |
| InChI | InChI=1S/C34H32S4/c35-28-9-1-24(2-10-28)32-18-22-17-23(19-32)21-33(20-22,25-3-11-29(36)12-4-25)34(32,26-5-13-30(37)14-6-26)27-7-15-31(38)16-8-27/h1-16,22-23,35-38H,17-21H2 |
| InChIKey | UOVIUGXNXGTDDD-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.90 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol?
The IUPAC name of 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol (CID 19003876) is 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol.
What is the SMILES notation for 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol?
The canonical SMILES for 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol is Sc1ccc(C23CC4CC(C2)CC(c2ccc(S)cc2)(C4)C3(c2ccc(S)cc2)c2ccc(S)cc2)cc1.
What is the InChIKey of 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol?
The InChIKey is UOVIUGXNXGTDDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H32S4/c35-28-9-1-24(2-10-28)32-18-22-17-23(19-32)21-33(20-22,25-3-11-29(36)12-4-25)34(32,26-5-13-30(37)14-6-26)27-7-15-31(38)16-8-27/h1-16,22-23,35-38H,17-21H2.
What are the key properties of 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol?
4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol has a molecular weight of 568.90 g/mol, XLogP of 9.23, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2,3-tris(4-sulfanylphenyl)-1-adamantyl]benzenethiol is sourced from PubChem (CID 19003876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).