About 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride
2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride (PubChem CID 19003912) has the molecular formula C9H16Cl2N2O
and a molecular weight of 239.15 g/mol. Its IUPAC name is 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride |
| PubChem CID | 19003912 |
| Molecular Formula | C9H16Cl2N2O |
| Molecular Weight | 239.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride |
| SMILES | COc1c(N)cc(C)c(N)c1C.Cl.Cl |
| InChI | InChI=1S/C9H14N2O.2ClH/c1-5-4-7(10)9(12-3)6(2)8(5)11;;/h4H,10-11H2,1-3H3;2*1H |
| InChIKey | JBESLYPTBIFSNQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.15 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride?
The IUPAC name of 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride (CID 19003912) is 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride.
What is the SMILES notation for 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride?
The canonical SMILES for 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride is COc1c(N)cc(C)c(N)c1C.Cl.Cl.
What is the InChIKey of 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride?
The InChIKey is JBESLYPTBIFSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O.2ClH/c1-5-4-7(10)9(12-3)6(2)8(5)11;;/h4H,10-11H2,1-3H3;2*1H.
What are the key properties of 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride?
2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride has a molecular weight of 239.15 g/mol, XLogP of 2.32, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3,5-dimethylbenzene-1,4-diamine;dihydrochloride is sourced from PubChem (CID 19003912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).