C12H18O8 — CID 19003989
2,3-dihydroxy-2,3-bis[(3-methyloxiran-2-yl)methyl]butanedioic acid (PubChem CID 19003989) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is 2,3-dihydroxy-2,3-bis[(3-methyloxiran-2-yl)methyl]butanedioic acid.
| Compound Name | 2,3-dihydroxy-2,3-bis[(3-methyloxiran-2-yl)methyl]butanedioic acid |
|---|---|
| PubChem CID | 19003989 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2,3-dihydroxy-2,3-bis[(3-methyloxiran-2-yl)methyl]butanedioic acid |
| SMILES | CC1OC1CC(O)(C(=O)O)C(O)(CC1OC1C)C(=O)O |
| InChI | InChI=1S/C12H18O8/c1-5-7(19-5)3-11(17,9(13)14)12(18,10(15)16)4-8-6(2)20-8/h5-8,17-18H,3-4H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | QFOJPDPTGTWVOS-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|